What is the molecular formula of toosendanin?
The molecular formula of toosendanin is C30H38O11.
What is the molecular weight of toosendanin?
The molecular weight of toosendanin is 574.6 g/mol.
What are the synonyms of toosendanin?
The synonyms of toosendanin are Chuanliansu and 12-Acetoxyamoorastatin.
What is the IUPAC name of toosendanin?
The IUPAC name of toosendanin is [(1S,2R,4R,5R,6S,8R,10S,11S,12R,14R,15R,16R,19S,21R)-4-acetyloxy-6-(furan-3-yl)-12,16,19-trihydroxy-5,11,15-trimethyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-21-yl] acetate.
What is the InChI of toosendanin?
The InChI of toosendanin is InChI=1S/C30H38O11/c1-13(31)39-20-10-19(34)29-12-38-25(36)26(20,3)17(29)9-18(33)28(5)23(29)22(35)24(40-14(2)32)27(4)16(15-6-7-37-11-15)8-21-30(27,28)41-21/h6-7,11,16-21,23-25,33-34,36H,8-10,12H2,1-5H3/t16-,17-,18+,19-,20+,21+,23-,24-,25+,26+,27+,28+,29+,30+/m0/s1.
What is the InChIKey of toosendanin?
The InChIKey of toosendanin is NAHTXVIXCMUDLF-RFNFAWMESA-N.
What is the canonical SMILES of toosendanin?
The canonical SMILES of toosendanin is CC(=O)OC1CC(C23COC(C1(C2CC(C4(C3C(=O)C(C5(C46C(O6)CC5C7=COC=C7)C)OC(=O)C)C)O)C)O)O.
What is the CAS number of toosendanin?
The CAS number of toosendanin is 58812-37-6.
What is the European Community (EC) number of toosendanin?
The European Community (EC) number of toosendanin is 683-199-2.
What is the hydrogen bond acceptor count of toosendanin?
The hydrogen bond acceptor count of toosendanin is 11.