What is the molecular formula of 2,5-Di-tert-butylphenol?
The molecular formula of 2,5-Di-tert-butylphenol is C14H22O.
What is the molecular weight of 2,5-Di-tert-butylphenol?
The molecular weight of 2,5-Di-tert-butylphenol is 206.32 g/mol.
What is the IUPAC name of 2,5-Di-tert-butylphenol?
The IUPAC name of 2,5-Di-tert-butylphenol is 2,5-ditert-butylphenol.
What is the InChI of 2,5-Di-tert-butylphenol?
The InChI of 2,5-Di-tert-butylphenol is InChI=1S/C14H22O/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9,15H,1-6H3.
What is the InChIKey of 2,5-Di-tert-butylphenol?
The InChIKey of 2,5-Di-tert-butylphenol is KDBZVULQVCUNNA-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Di-tert-butylphenol?
The canonical SMILES of 2,5-Di-tert-butylphenol is CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)O.
What is the CAS number of 2,5-Di-tert-butylphenol?
The CAS number of 2,5-Di-tert-butylphenol is 5875-45-6.
What is the molecular weight of 2,5-Di-tert-butylphenol according to PubChem?
The molecular weight of 2,5-Di-tert-butylphenol is 206.32 g/mol according to PubChem.
What is the XLogP3-AA value of 2,5-Di-tert-butylphenol?
The XLogP3-AA value of 2,5-Di-tert-butylphenol is 4.9.
What is the hydrogen bond donor count of 2,5-Di-tert-butylphenol?
The hydrogen bond donor count of 2,5-Di-tert-butylphenol is 1.