What is the molecular formula of Vinyl valerate?
The molecular formula of Vinyl valerate is C7H12O2.
What is the molecular weight of Vinyl valerate?
The molecular weight of Vinyl valerate is 128.17 g/mol.
What is the IUPAC name of Vinyl valerate?
The IUPAC name of Vinyl valerate is ethenyl pentanoate.
What is the InChI of Vinyl valerate?
The InChI of Vinyl valerate is InChI=1S/C7H12O2/c1-3-5-6-7(8)9-4-2/h4H,2-3,5-6H2,1H3.
What is the InChIKey of Vinyl valerate?
The InChIKey of Vinyl valerate is BLZSRIYYOIZLJL-UHFFFAOYSA-N.
What is the Canonical SMILES of Vinyl valerate?
The Canonical SMILES of Vinyl valerate is CCCCC(=O)OC=C.
What is the CAS number of Vinyl valerate?
The CAS number of Vinyl valerate is 5873-43-8.
What is the EC number of Vinyl valerate?
The EC number of Vinyl valerate is 227-533-3.
What is the DSSTox Substance ID of Vinyl valerate?
The DSSTox Substance ID of Vinyl valerate is DTXSID60974258.
Is Vinyl valerate a canonicalized compound?
Yes, Vinyl valerate is a canonicalized compound.