What is the molecular formula of Phenyl 1-hydroxy-2-naphthoate?
The molecular formula of Phenyl 1-hydroxy-2-naphthoate is C17H12O3.
What are the synonyms of Phenyl 1-hydroxy-2-naphthoate?
The synonyms of Phenyl 1-hydroxy-2-naphthoate are 1-Hydroxy-2-naphthoic acid phenyl ester, phenyl 1-hydroxynaphthalene-2-carboxylate, and 2-Naphthalenecarboxylic acid, 1-hydroxy-, phenyl ester.
What is the molecular weight of Phenyl 1-hydroxy-2-naphthoate?
The molecular weight of Phenyl 1-hydroxy-2-naphthoate is 264.27 g/mol.
What is the IUPAC name of Phenyl 1-hydroxy-2-naphthoate?
The IUPAC name of Phenyl 1-hydroxy-2-naphthoate is phenyl 1-hydroxynaphthalene-2-carboxylate.
What is the InChI of Phenyl 1-hydroxy-2-naphthoate?
The InChI of Phenyl 1-hydroxy-2-naphthoate is InChI=1S/C17H12O3/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13/h1-11,18H.
What is the InChIKey of Phenyl 1-hydroxy-2-naphthoate?
The InChIKey of Phenyl 1-hydroxy-2-naphthoate is QHDYIMWKSCJTIM-UHFFFAOYSA-N.
What is the canonical SMILES of Phenyl 1-hydroxy-2-naphthoate?
The canonical SMILES of Phenyl 1-hydroxy-2-naphthoate is C1=CC=C(C=C1)OC(=O)C2=C(C3=CC=CC=C3C=C2)O.
What is the CAS number of Phenyl 1-hydroxy-2-naphthoate?
The CAS number of Phenyl 1-hydroxy-2-naphthoate is 132-54-7.
What is the European Community (EC) number of Phenyl 1-hydroxy-2-naphthoate?
The European Community (EC) number of Phenyl 1-hydroxy-2-naphthoate is 205-065-0.
What is the ChEMBL ID of Phenyl 1-hydroxy-2-naphthoate?
The ChEMBL ID of Phenyl 1-hydroxy-2-naphthoate is CHEMBL3186248.
※ Please kindly note that our products are for research use only.