What is the molecular formula of p-Cumenesulphonic acid?
The molecular formula of p-Cumenesulphonic acid is C9H12O3S.
What is the molecular weight of p-Cumenesulphonic acid?
The molecular weight of p-Cumenesulphonic acid is 200.26 g/mol.
What is the IUPAC name of p-Cumenesulphonic acid?
The IUPAC name of p-Cumenesulphonic acid is 4-propan-2-ylbenzenesulfonic acid.
What is the InChIKey of p-Cumenesulphonic acid?
The InChIKey of p-Cumenesulphonic acid is CVLHGLWXLDOELD-UHFFFAOYSA-N.
What is the canonical SMILES of p-Cumenesulphonic acid?
The canonical SMILES of p-Cumenesulphonic acid is CC(C)C1=CC=C(C=C1)S(=O)(=O)O.
What is the CAS number of p-Cumenesulphonic acid?
The CAS number of p-Cumenesulphonic acid is 16066-35-6.
How many hydrogen bond donor counts does p-Cumenesulphonic acid have?
p-Cumenesulphonic acid has one hydrogen bond donor count.
How many hydrogen bond acceptor counts does p-Cumenesulphonic acid have?
p-Cumenesulphonic acid has three hydrogen bond acceptor counts.
How many rotatable bond counts does p-Cumenesulphonic acid have?
p-Cumenesulphonic acid has two rotatable bond counts.
What is the topological polar surface area of p-Cumenesulphonic acid?
The topological polar surface area of p-Cumenesulphonic acid is 62.8 ?2.