The molecular formula of the compound is C40H30N8O8Ru.
What are the synonyms of the compound?
The synonyms of the compound are BIS-(BIPYRIDIN)-4 4'-DICARBOXYBIPYRI.-RU, (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyridin-2-yl]pyridine-4-carboxylate;2-pyridin-2-ylpyridine;ruthenium Bis-(bipyridin)-4 4-dicarboxybipyri.-ru.
What is the molecular weight of the compound?
The molecular weight of the compound is 851.8 g/mol.
What is the parent compound of the compound?
The parent compound of the compound is CID 9940844 (2,5-Pyrrolidinedione, 1,1'-[[2,2'-bipyridine]-4,4'-diylbis(carbonyloxy)]bis-).
What are the component compounds of the compound?
The component compounds of the compound are CID 1474 (2,2'-Bipyridine), CID 23950 (Ruthenium), and CID 9940844 (2,5-Pyrrolidinedione, 1,1'-[[2,2'-bipyridine]-4,4'-diylbis(carbonyloxy)]bis-).
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2,5-dioxopyrrolidin-1-yl) 2-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyridin-2-yl]pyridine-4-carboxylate;2-pyridin-2-ylpyridine;ruthenium.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C20H14N4O8.2C10H8N2.Ru/c25-15-1-2-16(26)23(15)31-19(29)11-5-7-21-13(9-11)14-10-12(6-8-22-14)20(30)32-24-17(27)3-4-18(24)28;2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h5-10H,1-4H2;2*1-8H;.
What is the InChIKey of the compound?
The InChIKey of the compound is QZWOLOZSLWBDCH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CC(=O)N(C1=O)OC(=O)C2=CC(=NC=C2)C3=NC=CC(=C3)C(=O)ON4C(=O)CCC4=O.C1=CC=NC(=C1)C2=CC=CC=N2.C1=CC=NC(=C1)C2=CC=CC=N2.[Ru].
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 0.
※ Please kindly note that our products are for research use only.