What is the molecular formula of Isodecyl diphenyl phosphite?
The molecular formula of Isodecyl diphenyl phosphite is C22H31O3P.
What is the molecular weight of Isodecyl diphenyl phosphite?
The molecular weight of Isodecyl diphenyl phosphite is 374.5 g/mol.
What are the synonyms of Isodecyl diphenyl phosphite?
The synonyms of Isodecyl diphenyl phosphite are Weston DPDP, 8-methylnonyl diphenyl phosphite, and Chelex MD.
When was the compound created?
The compound was created on October 25, 2006.
What is the IUPAC name of Isodecyl diphenyl phosphite?
The IUPAC name of Isodecyl diphenyl phosphite is 8-methylnonyl diphenyl phosphite.
What is the InChI of Isodecyl diphenyl phosphite?
The InChI of Isodecyl diphenyl phosphite is InChI=1S/C22H31O3P/c1-20(2)14-8-4-3-5-13-19-23-26(24-21-15-9-6-10-16-21)25-22-17-11-7-12-18-22/h6-7,9-12,15-18,20H,3-5,8,13-14,19H2,1-2H3.
What is the InChIKey of Isodecyl diphenyl phosphite?
The InChIKey of Isodecyl diphenyl phosphite is ADRNSOYXKABLGT-UHFFFAOYSA-N.
What is the canonical SMILES representation of Isodecyl diphenyl phosphite?
The canonical SMILES representation of Isodecyl diphenyl phosphite is CC(C)CCCCCCCOP(OC1=CC=CC=C1)OC2=CC=CC=C2.
What is the CAS number of Isodecyl diphenyl phosphite?
The CAS number of Isodecyl diphenyl phosphite is 26544-23-0.
What is the physical description of Isodecyl diphenyl phosphite?
Isodecyl diphenyl phosphite can exist as a dry powder or a liquid.
※ Please kindly note that our products are for research use only.