What is the molecular formula of sucrose palmitate?
The molecular formula of sucrose palmitate is C28H52O12.
What are the synonyms of sucrose palmitate?
The synonyms of sucrose palmitate are Sucrose palmitate (VAN), EINECS 247-706-7, NSC 192746, and Sucrose palmitate [NF].
What is the molecular weight of sucrose palmitate?
The molecular weight of sucrose palmitate is 580.7 g/mol.
When was sucrose palmitate created?
Sucrose palmitate was created on August 8, 2005.
What is the IUPAC name of sucrose palmitate?
The IUPAC name of sucrose palmitate is [(2S,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hexadecanoate.
What is the InChI of sucrose palmitate?
The InChI of sucrose palmitate is InChI=1S/C28H52O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(32)40-28(26(37)24(35)22(33)19(16-29)39-28)27(18-31)25(36)23(34)20(17-30)38-27/h19-20,22-26,29-31,33-37H,2-18H2,1H3/t19-,20-,22-,23-,24+,25+,26-,27+,28+/m1/s1.
What is the InChIKey of sucrose palmitate?
The InChIKey of sucrose palmitate is ZPVGIKNDGJGLCO-VGAMQAOUSA-N.
What is the canonical SMILES of sucrose palmitate?
The canonical SMILES of sucrose palmitate is CCCCCCCCCCCCCCCC(=O)OC1(C(C(C(C(O1)CO)O)O)O)C2(C(C(C(O2)CO)O)O)CO.
What is the CAS number of sucrose palmitate?
The CAS number of sucrose palmitate is 26446-38-8.
What is the XLogP3-AA value of sucrose palmitate?
The XLogP3-AA value of sucrose palmitate is 3.2.