What is the molecular formula of Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
The molecular formula is C9H11NO3.
What are the synonyms for Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
Some synonyms include Ethyl 6-(hydroxymethyl)picolinate, 2-Pyridinecarboxylic acid, 6-(hydroxymethyl)-, ethyl ester, and 6-HYDROXYMETHYL-PYRIDINE-2-CARBOXYLIC ACID ETHYL ESTER.
What is the CAS number of Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
The CAS number is 41337-81-9.
What is the IUPAC name of Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
The IUPAC name is ethyl 6-(hydroxymethyl)pyridine-2-carboxylate.
What is the InChI of Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
The InChI is InChI=1S/C9H11NO3/c1-2-13-9(12)8-5-3-4-7(6-11)10-8/h3-5,11H,2,6H2,1H3.
What is the molecular weight of Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
The molecular weight is 181.19 g/mol.
How many hydrogen bond donor counts are there in Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
There are 4 hydrogen bond acceptor counts.
How many rotatable bond counts are there in Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate?
There are 4 rotatable bond counts.
Is Ethyl 6-(hydroxymethyl)pyridine-2-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.