What is the molecular formula of fluoroacetone?
The molecular formula of fluoroacetone is C3H5FO.
What is the molecular weight of fluoroacetone?
The molecular weight of fluoroacetone is 76.07 g/mol.
What is the IUPAC name of fluoroacetone?
The IUPAC name of fluoroacetone is 1-fluoropropan-2-one.
What is the InChI of fluoroacetone?
The InChI of fluoroacetone is InChI=1S/C3H5FO/c1-3(5)2-4/h2H2,1H3.
What is the InChIKey of fluoroacetone?
The InChIKey of fluoroacetone is MSWVMWGCNZQPIA-UHFFFAOYSA-N.
What is the canonical SMILES of fluoroacetone?
The canonical SMILES of fluoroacetone is CC(=O)CF.
What is the CAS number of fluoroacetone?
The CAS number of fluoroacetone is 430-51-3.
What is the EC number of fluoroacetone?
The EC number of fluoroacetone is 207-064-0.
What is the UNII of fluoroacetone?
The UNII of fluoroacetone is 735L3MV2UG.
Is fluoroacetone a canonicalized compound?
Yes, fluoroacetone is a canonicalized compound according to PubChem.