What is the PubChem CID of the compound?
PubChem CID is 58943284.
What is the molecular formula of the compound?
The molecular formula is C45H29N5.
What are the synonyms of the compound?
The synonyms include DCzTRZ, 1106730-48-6, 9,9'-(5-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3-phenylene)bis(9H-carbazole), and more.
What is the molecular weight of the compound?
The molecular weight is 639.7 g/mol.
When was the compound created and last modified?
The compound was created on 2012-08-19 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name is 9-[3-carbazol-9-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
What is the InChI of the compound?
The InChI is InChI=1S/C45H29N5/c1-3-15-30(16-4-1)43-46-44(31-17-5-2-6-18-31)48-45(47-43)32-27-33(49-39-23-11-7-19-35(39)36-20-8-12-24-40(36)49)29-34(28-32)50-41-25-13-9-21-37(41)38-22-10-14-26-42(38)50/h1-29H.
What is the InChIKey of the compound?
The InChIKey is SWUBEMMFTUPINB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=CC(=C3)N4C5=CC=CC=C5C6=CC=CC=C64)N7C8=CC=CC=C8C9=CC=CC=C97)C1=CC=CC=C1.
What is the Nikkaji Number of the compound?
The Nikkaji Number is J3.394.611B.