What is the molecular formula of ACRSA?
The molecular formula of ACRSA is C32H21NO.
What is the PubChem CID of ACRSA?
The PubChem CID of ACRSA is 59156120.
What is the molecular weight of ACRSA?
The molecular weight of ACRSA is 435.5 g/mol.
When was ACRSA created?
ACRSA was created on August 20, 2012.
What is the IUPAC name of ACRSA?
The IUPAC name of ACRSA is 10-phenylspiro[acridine-9,10'-anthracene]-9'-one.
What is the InChI of ACRSA?
The InChI of ACRSA is InChI=1S/C32H21NO/c34-31-23-14-4-6-16-25(23)32(26-17-7-5-15-24(26)31)27-18-8-10-20-29(27)33(22-12-2-1-3-13-22)30-21-11-9-19-28(30)32/h1-21H.
What is the InChIKey of ACRSA?
The InChIKey of ACRSA is ASXSTQHYXCIZRV-UHFFFAOYSA-N.
What is the canonical SMILES of ACRSA?
The canonical SMILES of ACRSA is C1=CC=C(C=C1)N2C3=CC=CC=C3C4(C5=CC=CC=C5C(=O)C6=CC=CC=C64)C7=CC=CC=C72.
What is the XLogP3-AA value of ACRSA?
The XLogP3-AA value of ACRSA is 7.8.
Is ACRSA a canonicalized compound?
Yes, ACRSA is a canonicalized compound.