What is the molecular formula of cis-Aconitic anhydride?
The molecular formula of cis-Aconitic anhydride is C6H4O5.
What is the molecular weight of cis-Aconitic anhydride?
The molecular weight of cis-Aconitic anhydride is 156.09 g/mol.
What is the IUPAC name of cis-Aconitic anhydride?
The IUPAC name of cis-Aconitic anhydride is 2-(2,5-dioxofuran-3-yl)acetic acid.
What is the InChI of cis-Aconitic anhydride?
The InChI of cis-Aconitic anhydride is InChI=1S/C6H4O5/c7-4(8)1-3-2-5(9)11-6(3)10/h2H,1H2,(H,7,8).
What is the InChIKey of cis-Aconitic anhydride?
The InChIKey of cis-Aconitic anhydride is GVJRTUUUJYMTNQ-UHFFFAOYSA-N.
What is the canonical SMILES of cis-Aconitic anhydride?
The canonical SMILES of cis-Aconitic anhydride is C1=C(C(=O)OC1=O)CC(=O)O.
What is the CAS number of cis-Aconitic anhydride?
The CAS number of cis-Aconitic anhydride is 6318-55-4.
What is the European Community (EC) number of cis-Aconitic anhydride?
The European Community (EC) number of cis-Aconitic anhydride is 250-668-4.
What is the UNII of cis-Aconitic anhydride?
The UNII of cis-Aconitic anhydride is 6G00QN452A.
What is the XLogP3-AA value of cis-Aconitic anhydride?
The XLogP3-AA value of cis-Aconitic anhydride is -0.7.