What is the molecular formula of butyl oleate?
The molecular formula of butyl oleate is C22H42O2.
What is the molecular weight of butyl oleate?
The molecular weight of butyl oleate is 338.6 g/mol.
How is butyl oleate synthesized?
Butyl oleate is synthesized by the formal condensation of the hydroxy group of butan-1-ol with the carboxy group of oleic acid.
What is the IUPAC name of butyl oleate?
The IUPAC name of butyl oleate is butyl (Z)-octadec-9-enoate.
What is the InChI of butyl oleate?
The InChI of butyl oleate is InChI=1S/C22H42O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(23)24-21-6-4-2/h12-13H,3-11,14-21H2,1-2H3/b13-12-.
What is the CAS number of butyl oleate?
The CAS number of butyl oleate is 142-77-8.
What is the EC number of butyl oleate?
The EC number of butyl oleate is 205-559-6.
What is the ChEMBL ID of butyl oleate?
The ChEMBL ID of butyl oleate is CHEMBL3183174.
How many hydrogen bond donor counts does butyl oleate have?
Butyl oleate has zero hydrogen bond donor counts.
How many rotatable bond counts does butyl oleate have?
Butyl oleate has 19 rotatable bond counts.