What is the PubChem CID of Benzhexol hydrochloride?
The PubChem CID of Benzhexol hydrochloride is 66007.
What is the molecular formula of Benzhexol hydrochloride?
The molecular formula of Benzhexol hydrochloride is C20H32ClNO.
What is the molecular weight of Benzhexol hydrochloride?
The molecular weight of Benzhexol hydrochloride is 337.9 g/mol.
What is the IUPAC name of Benzhexol hydrochloride?
The IUPAC name of Benzhexol hydrochloride is 1-cyclohexyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride.
What is the InChIKey of Benzhexol hydrochloride?
The InChIKey of Benzhexol hydrochloride is QDWJJTJNXAKQKD-UHFFFAOYSA-N.
What is the canonical SMILES of Benzhexol hydrochloride?
The canonical SMILES of Benzhexol hydrochloride is C1CCC(CC1)C(CCN2CCCCC2)(C3=CC=CC=C3)O.Cl.
What is the CAS number of Benzhexol hydrochloride?
The CAS number of Benzhexol hydrochloride is 52-49-3.
What is the ChEMBL ID of Benzhexol hydrochloride?
The ChEMBL ID of Benzhexol hydrochloride is CHEMBL1092.
What is the UNII of Benzhexol hydrochloride?
The UNII of Benzhexol hydrochloride is AO61G82577.
What is the NCI Thesaurus Code of Benzhexol hydrochloride?
The NCI Thesaurus Code of Benzhexol hydrochloride is C47771.