What is the PubChem CID of flunarizine?
The PubChem CID of flunarizine is 941361.
What is the molecular formula of flunarizine?
The molecular formula of flunarizine is C26H26F2N2.
What is the molecular weight of flunarizine?
The molecular weight of flunarizine is 404.5 g/mol.
What is the IUPAC name of flunarizine?
The IUPAC name of flunarizine is 1-[bis(4-fluorophenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine.
What is the InChIKey of flunarizine?
The InChIKey of flunarizine is SMANXXCATUTDDT-QPJJXVBHSA-N.
What is the canonical SMILES of flunarizine?
The canonical SMILES of flunarizine is C1CN(CCN1CC=CC2=CC=CC=C2)C(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F.
What is the CAS number of flunarizine?
The CAS number of flunarizine is 52468-60-7.
What is the ChEMBL ID of flunarizine?
The ChEMBL ID of flunarizine is CHEMBL30008.
What is the UNII of flunarizine?
The UNII of flunarizine is R7PLA2DM0J.
What is the Wikipedia page for flunarizine?
The Wikipedia page for flunarizine can be accessed under the title "Flunarizine."