What is the PubChem CID of 9-Bromofluorene?
The PubChem CID of 9-Bromofluorene is 16024.
What is the molecular formula of 9-Bromofluorene?
The molecular formula of 9-Bromofluorene is C13H9Br.
What is the molecular weight of 9-Bromofluorene?
The molecular weight of 9-Bromofluorene is 245.11 g/mol.
What is the IUPAC name of 9-Bromofluorene?
The IUPAC name of 9-Bromofluorene is 9-bromo-9H-fluorene.
What is the InChI of 9-Bromofluorene?
The InChI of 9-Bromofluorene is InChI=1S/C13H9Br/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H.
What is the InChIKey of 9-Bromofluorene?
The InChIKey of 9-Bromofluorene is AHCDKANCCBEQJJ-UHFFFAOYSA-N.
What is the canonical SMILES of 9-Bromofluorene?
The canonical SMILES of 9-Bromofluorene is C1=CC=C2C(=C1)C(C3=CC=CC=C32)Br.
What is the CAS number of 9-Bromofluorene?
The CAS number of 9-Bromofluorene is 1940-57-4.
What is the European Community (EC) number of 9-Bromofluorene?
The European Community (EC) number of 9-Bromofluorene is 217-722-9.
Is 9-Bromofluorene a canonicalized compound?
Yes, 9-Bromofluorene is a canonicalized compound.