What is the molecular formula of 4-Phenylbenzyl chloride?
The molecular formula of 4-Phenylbenzyl chloride is C13H11Cl.
What is the molecular weight of 4-Phenylbenzyl chloride?
The molecular weight of 4-Phenylbenzyl chloride is 202.68 g/mol.
What is the IUPAC name of 4-Phenylbenzyl chloride?
The IUPAC name of 4-Phenylbenzyl chloride is 1-(chloromethyl)-4-phenylbenzene.
What is the InChI of 4-Phenylbenzyl chloride?
The InChI of 4-Phenylbenzyl chloride is InChI=1S/C13H11Cl/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2.
What is the InChIKey of 4-Phenylbenzyl chloride?
The InChIKey of 4-Phenylbenzyl chloride is HLQZCRVEEQKNMS-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Phenylbenzyl chloride?
The canonical SMILES of 4-Phenylbenzyl chloride is C1=CC=C(C=C1)C2=CC=C(C=C2)CCl.
What is the CAS number of 4-Phenylbenzyl chloride?
The CAS number of 4-Phenylbenzyl chloride is 1667-11-4.
What is the European Community (EC) number of 4-Phenylbenzyl chloride?
The European Community (EC) number of 4-Phenylbenzyl chloride is 216-786-5.
What is the molecular weight of 4-Phenylbenzyl chloride according to PubChem?
The molecular weight of 4-Phenylbenzyl chloride is 202.68 g/mol according to PubChem.
Is 4-Phenylbenzyl chloride a canonicalized compound?
Yes, 4-Phenylbenzyl chloride is a canonicalized compound according to PubChem.