What is the molecular formula of 4-methyl-5-nonanone?
The molecular formula of 4-methyl-5-nonanone is C10H20O.
What is the molecular weight of 4-methyl-5-nonanone?
The molecular weight of 4-methyl-5-nonanone is 156.26 g/mol.
What is the IUPAC name of 4-methyl-5-nonanone?
The IUPAC name of 4-methyl-5-nonanone is 4-methylnonan-5-one.
What is the InChI of 4-methyl-5-nonanone?
The InChI of 4-methyl-5-nonanone is InChI=1S/C10H20O/c1-4-6-8-10(11)9(3)7-5-2/h9H,4-8H2,1-3H3.
What is the InChIKey of 4-methyl-5-nonanone?
The InChIKey of 4-methyl-5-nonanone is CGHJMKONNFWXHO-UHFFFAOYSA-N.
What is the canonical SMILES of 4-methyl-5-nonanone?
The canonical SMILES of 4-methyl-5-nonanone is CCCCC(=O)C(C)CCC.
What is the CAS number of 4-methyl-5-nonanone?
The CAS number of 4-methyl-5-nonanone is 35900-26-6.
What is the XLogP3-AA value of 4-methyl-5-nonanone?
The XLogP3-AA value of 4-methyl-5-nonanone is 3.3.
How many hydrogen bond donor counts does 4-methyl-5-nonanone have?
4-methyl-5-nonanone has 0 hydrogen bond donor counts.
How many rotatable bond counts does 4-methyl-5-nonanone have?
4-methyl-5-nonanone has 6 rotatable bond counts.