What is the molecular formula of E-5-Decenyl acetate?
The molecular formula of E-5-Decenyl acetate is C12H22O2.
What is the molecular weight of E-5-Decenyl acetate?
The molecular weight of E-5-Decenyl acetate is 198.30 g/mol.
What is the IUPAC name of E-5-Decenyl acetate?
The IUPAC name of E-5-Decenyl acetate is [(E)-dec-5-enyl] acetate.
What is the InChI of E-5-Decenyl acetate?
The InChI of E-5-Decenyl acetate is InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h6-7H,3-5,8-11H2,1-2H3/b7-6+.
What is the InChIKey of E-5-Decenyl acetate?
The InChIKey of E-5-Decenyl acetate is VTUFOIHYMMMNOM-VOTSOKGWSA-N.
What is the CAS number of E-5-Decenyl acetate?
The CAS number of E-5-Decenyl acetate is 38421-90-8.
How many hydrogen bond donor counts does E-5-Decenyl acetate have?
E-5-Decenyl acetate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does E-5-Decenyl acetate have?
E-5-Decenyl acetate has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does E-5-Decenyl acetate have?
E-5-Decenyl acetate has 9 rotatable bond counts.
What is the topological polar surface area of E-5-Decenyl acetate?
The topological polar surface area of E-5-Decenyl acetate is 26.3?2.