What is the molecular formula of 4-Benzyloxyindole?
The molecular formula of 4-Benzyloxyindole is C15H13NO.
What is the molecular weight of 4-Benzyloxyindole?
The molecular weight of 4-Benzyloxyindole is 223.27 g/mol.
What is the IUPAC name of 4-Benzyloxyindole?
The IUPAC name of 4-Benzyloxyindole is 4-phenylmethoxy-1H-indole.
What is the InChI of 4-Benzyloxyindole?
The InChI of 4-Benzyloxyindole is InChI=1S/C15H13NO/c1-2-5-12(6-3-1)11-17-15-8-4-7-14-13(15)9-10-16-14/h1-10,16H,11H2.
What is the InChIKey of 4-Benzyloxyindole?
The InChIKey of 4-Benzyloxyindole is LJFVSIDBFJPKLD-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Benzyloxyindole?
The canonical SMILES of 4-Benzyloxyindole is C1=CC=C(C=C1)COC2=CC=CC3=C2C=CN3.
What is the CAS number of 4-Benzyloxyindole?
The CAS number of 4-Benzyloxyindole is 20289-26-3.
What is the European Community (EC) number of 4-Benzyloxyindole?
The European Community (EC) number of 4-Benzyloxyindole is 243-690-0.
What is the DSSTox Substance ID of 4-Benzyloxyindole?
The DSSTox Substance ID of 4-Benzyloxyindole is DTXSID60174155.
Is 4-Benzyloxyindole canonicalized?
Yes, 4-Benzyloxyindole is canonicalized according to PubChem.