What is the molecular formula of 6-Methyl-4-nitroindole?
The molecular formula of 6-Methyl-4-nitroindole is C9H8N2O2.
When was 6-Methyl-4-nitroindole created?
6-Methyl-4-nitroindole was created on February 29, 2008.
What is the IUPAC name of 6-Methyl-4-nitroindole?
The IUPAC name of 6-Methyl-4-nitroindole is 6-methyl-4-nitro-1H-indole.
What is the InChI of 6-Methyl-4-nitroindole?
The InChI of 6-Methyl-4-nitroindole is InChI=1S/C9H8N2O2/c1-6-4-8-7(2-3-10-8)9(5-6)11(12)13/h2-5,10H,1H3.
What is the Canonical SMILES of 6-Methyl-4-nitroindole?
The Canonical SMILES of 6-Methyl-4-nitroindole is CC1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-].
What is the molecular weight of 6-Methyl-4-nitroindole?
The molecular weight of 6-Methyl-4-nitroindole is 176.17 g/mol.
How many hydrogen bond donor counts does 6-Methyl-4-nitroindole have?
6-Methyl-4-nitroindole has 1 hydrogen bond donor count.
What is the topological polar surface area of 6-Methyl-4-nitroindole?
The topological polar surface area of 6-Methyl-4-nitroindole is 61.6 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
When was 6-Methyl-4-nitroindole last modified?
6-Methyl-4-nitroindole was last modified on December 30, 2023.