What is the molecular formula of 2-Bromo-5-iodotoluene?
The molecular formula of 2-Bromo-5-iodotoluene is C7H6BrI.
What is the molecular weight of 2-Bromo-5-iodotoluene?
The molecular weight of 2-Bromo-5-iodotoluene is 296.93 g/mol.
What is the IUPAC name of 2-Bromo-5-iodotoluene?
The IUPAC name of 2-Bromo-5-iodotoluene is 1-bromo-4-iodo-2-methylbenzene.
What is the InChI of 2-Bromo-5-iodotoluene?
The InChI of 2-Bromo-5-iodotoluene is InChI=1S/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-5-iodotoluene?
The InChIKey of 2-Bromo-5-iodotoluene is QSQOGKONVJDRNH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromo-5-iodotoluene?
The Canonical SMILES of 2-Bromo-5-iodotoluene is CC1=C(C=CC(=C1)I)Br.
What is the CAS number of 2-Bromo-5-iodotoluene?
The CAS number of 2-Bromo-5-iodotoluene is 202865-85-8.
What is the European Community (EC) number of 2-Bromo-5-iodotoluene?
The European Community (EC) number of 2-Bromo-5-iodotoluene is 640-232-5.
What is the DSSTox Substance ID of 2-Bromo-5-iodotoluene?
The DSSTox Substance ID of 2-Bromo-5-iodotoluene is DTXSID10370807.
Is 2-Bromo-5-iodotoluene a canonicalized compound?
Yes, 2-Bromo-5-iodotoluene is a canonicalized compound according to PubChem.