What is the molecular formula of the compound referenced?
The molecular formula is C8H6BrFO.
What are the synonyms of the compound?
The synonyms are 4-BROMO-2-FLUORO-5-METHYLBENZALDEHYDE, 916792-23-9, 4-Bromo-2-fluoro-5-methyl-benzaldehyde, MFCD07782048, and Benzaldehyde, 4-bromo-2-fluoro-5-methyl-.
What is the molecular weight of the compound?
The molecular weight is 217.03 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 4-bromo-2-fluoro-5-methylbenzaldehyde.
What is the InChI code of the compound?
The InChI code is InChI=1S/C8H6BrFO/c1-5-2-6(4-11)8(10)3-7(5)9/h2-4H,1H3.
What is the InChIKey of the compound?
The InChIKey is RKISJSZBSQUZSJ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC1=CC(=C(C=C1Br)F)C=O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 2.5.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.