What is the molecular formula of 2,6-Difluorotoluene?
The molecular formula of 2,6-Difluorotoluene is C7H6F2.
What is the molecular weight of 2,6-Difluorotoluene?
The molecular weight of 2,6-Difluorotoluene is 128.12 g/mol.
What is the IUPAC name of 2,6-Difluorotoluene?
The IUPAC name of 2,6-Difluorotoluene is 1,3-difluoro-2-methylbenzene.
What is the InChI of 2,6-Difluorotoluene?
The InChI of 2,6-Difluorotoluene is InChI=1S/C7H6F2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2,6-Difluorotoluene?
The InChIKey of 2,6-Difluorotoluene is MZLSNIREOQCDED-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluorotoluene?
The canonical SMILES of 2,6-Difluorotoluene is CC1=C(C=CC=C1F)F.
What is the CAS number of 2,6-Difluorotoluene?
The CAS number of 2,6-Difluorotoluene is 443-84-5.
What is the European Community (EC) number of 2,6-Difluorotoluene?
The European Community (EC) number of 2,6-Difluorotoluene is 623-587-0.
What is the DSSTox Substance ID of 2,6-Difluorotoluene?
The DSSTox Substance ID of 2,6-Difluorotoluene is DTXSID00963202.
Is 2,6-Difluorotoluene canonicalized?
Yes, 2,6-Difluorotoluene is canonicalized.