What is the molecular formula of 2-Chloro-6-fluorotoluene?
The molecular formula of 2-Chloro-6-fluorotoluene is C7H6ClF.
What is the molecular weight of 2-Chloro-6-fluorotoluene?
The molecular weight of 2-Chloro-6-fluorotoluene is 144.57 g/mol.
What is the IUPAC name of 2-Chloro-6-fluorotoluene?
The IUPAC name of 2-Chloro-6-fluorotoluene is 1-chloro-3-fluoro-2-methylbenzene.
What is the InChI of 2-Chloro-6-fluorotoluene?
The InChI of 2-Chloro-6-fluorotoluene is InChI=1S/C7H6ClF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2-Chloro-6-fluorotoluene?
The InChIKey of 2-Chloro-6-fluorotoluene is FNPVYRJTBXHIPB-UHFFFAOYSA-N.
What is the CAS number of 2-Chloro-6-fluorotoluene?
The CAS number of 2-Chloro-6-fluorotoluene is 443-83-4.
What is the European Community (EC) Number of 2-Chloro-6-fluorotoluene?
The European Community (EC) Number of 2-Chloro-6-fluorotoluene is 207-141-9.
What is the DSSTox Substance ID of 2-Chloro-6-fluorotoluene?
The DSSTox Substance ID of 2-Chloro-6-fluorotoluene is DTXSID1059997.
What is the Nikkaji Number of 2-Chloro-6-fluorotoluene?
The Nikkaji Number of 2-Chloro-6-fluorotoluene is J149.703K.
Is 2-Chloro-6-fluorotoluene a canonicalized compound?
Yes, 2-Chloro-6-fluorotoluene is a canonicalized compound.