What is the molecular formula of nomegestrol?
The molecular formula of nomegestrol is C21H28O3.
What is the molecular weight of nomegestrol?
The molecular weight of nomegestrol is 328.4 g/mol.
What is the IUPAC name of nomegestrol?
The IUPAC name of nomegestrol is (8S,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-6,13-dimethyl-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
What are the synonyms of nomegestrol?
The synonyms of nomegestrol include Nomegestrolum, 17-Hydroxy-6-methyl-19-norpregna-4,6-diene-3,20-dione, and 17-Hydroxy-6-methyl-19-nor-4,6-pregnadiene-3,20-dione.
What is the InChIKey of nomegestrol?
The InChIKey of nomegestrol is KZUIYQJTUIACIG-YBZCJVABSA-N.
What is the canonical SMILES of nomegestrol?
The canonical SMILES of nomegestrol is CC1=CC2C(CCC3(C2CCC3(C(=O)C)O)C)C4C1=CC(=O)CC4.
What is the CAS number of nomegestrol?
The CAS number of nomegestrol is 58691-88-6.
What is the UNII of nomegestrol?
The UNII of nomegestrol is 10F89177CO.
What is the ChEMBL ID of nomegestrol?
The ChEMBL ID of nomegestrol is CHEMBL2105722.
Is nomegestrol an ingredient in the EMA-authorised product Zoely?
Yes, nomegestrol is an ingredient in the EMA-authorised product Zoely.