What is the molecular formula of 18-Hydroxyprogesterone?
The molecular formula of 18-Hydroxyprogesterone is C21H30O3.
What is the molecular weight of 18-Hydroxyprogesterone?
The molecular weight of 18-Hydroxyprogesterone is 330.5 g/mol.
When was 18-Hydroxyprogesterone created in PubChem?
18-Hydroxyprogesterone was created in PubChem on August 8, 2005.
When was 18-Hydroxyprogesterone last modified in PubChem?
18-Hydroxyprogesterone was last modified in PubChem on November 25, 2023.
What is the IUPAC name of 18-Hydroxyprogesterone?
The IUPAC name of 18-Hydroxyprogesterone is (8R,9S,10R,13R,14S,17S)-17-acetyl-13-(hydroxymethyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
What is the InChI of 18-Hydroxyprogesterone?
The InChI of 18-Hydroxyprogesterone is InChI=1S/C21H30O3/c1-13(23)17-5-6-19-16-4-3-14-11-15(24)7-9-20(14,2)18(16)8-10-21(17,19)12-22/h11,16-19,22H,3-10,12H2,1-2H3/t16-,17-,18+,19+,20+,21+/m1/s1.
What is the InChIKey of 18-Hydroxyprogesterone?
The InChIKey of 18-Hydroxyprogesterone is QFNCSEWPJSDMED-OFELHODLSA-N.
What is the canonical SMILES of 18-Hydroxyprogesterone?
The canonical SMILES of 18-Hydroxyprogesterone is CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CC[C@]34C)CO.
What is the CAS number of 18-Hydroxyprogesterone?
The CAS number of 18-Hydroxyprogesterone is 596-69-0.
What is the hydrogen bond donor count of 18-Hydroxyprogesterone?
The hydrogen bond donor count of 18-Hydroxyprogesterone is 1.