What is the molecular formula of N,N-Dimethyloctylamine?
The molecular formula of N,N-Dimethyloctylamine is C10H23N.
What is the molecular weight of N,N-Dimethyloctylamine?
The molecular weight of N,N-Dimethyloctylamine is 157.30 g/mol.
What is the IUPAC name of N,N-Dimethyloctylamine?
The IUPAC name of N,N-Dimethyloctylamine is N,N-dimethyloctan-1-amine.
What is the InChI of N,N-Dimethyloctylamine?
The InChI of N,N-Dimethyloctylamine is InChI=1S/C10H23N/c1-4-5-6-7-8-9-10-11(2)3/h4-10H2,1-3H3.
What is the InChIKey of N,N-Dimethyloctylamine?
The InChIKey of N,N-Dimethyloctylamine is UQKAOOAFEFCDGT-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dimethyloctylamine?
The canonical SMILES of N,N-Dimethyloctylamine is CCCCCCCCN(C)C.
What is the CAS number of N,N-Dimethyloctylamine?
The CAS number of N,N-Dimethyloctylamine is 7378-99-6.
What is the European Community (EC) number of N,N-Dimethyloctylamine?
The European Community (EC) number of N,N-Dimethyloctylamine is 230-939-3.
What is the ChEMBL ID of N,N-Dimethyloctylamine?
The ChEMBL ID of N,N-Dimethyloctylamine is CHEMBL3183197.
What is the XLogP3 value of N,N-Dimethyloctylamine?
The XLogP3 value of N,N-Dimethyloctylamine is 4.2.