What is the PubChem CID for Propiolamide?
The PubChem CID for Propiolamide is 101445.
What is the molecular formula of Propiolamide?
The molecular formula of Propiolamide is C3H3NO.
What are some synonyms for Propiolamide?
Some synonyms for Propiolamide include prop-2-ynamide, 2-Propynamide, and Propynamide.
What is the molecular weight of Propiolamide?
The molecular weight of Propiolamide is 69.06 g/mol.
When was Propiolamide created?
Propiolamide was created on March 26, 2005.
What is the IUPAC name of Propiolamide?
The IUPAC name of Propiolamide is prop-2-ynamide.
What is the InChI of Propiolamide?
The InChI of Propiolamide is InChI=1S/C3H3NO/c1-2-3(4)5/h1H,(H2,4,5).
What is the InChIKey of Propiolamide?
The InChIKey of Propiolamide is HCJTYESURSHXNB-UHFFFAOYSA-N.
What is the canonical SMILES of Propiolamide?
The canonical SMILES of Propiolamide is C#CC(=O)N.
What is the CAS number of Propiolamide?
The CAS number of Propiolamide is 7341-96-0.