What is the molecular formula of Methyl-6-bromohexanoate?
The molecular formula of Methyl-6-bromohexanoate is C7H13BrO2.
What is the molecular weight of Methyl-6-bromohexanoate?
The molecular weight of Methyl-6-bromohexanoate is 209.08 g/mol.
What is the IUPAC name of Methyl-6-bromohexanoate?
The IUPAC name of Methyl-6-bromohexanoate is methyl 6-bromohexanoate.
What is the InChI of Methyl-6-bromohexanoate?
The InChI of Methyl-6-bromohexanoate is InChI=1S/C7H13BrO2/c1-10-7(9)5-3-2-4-6-8/h2-6H2,1H3.
What is the InChIKey of Methyl-6-bromohexanoate?
The InChIKey of Methyl-6-bromohexanoate is KYLVAMSNNZMHSX-UHFFFAOYSA-N.
What is the CAS number of Methyl-6-bromohexanoate?
The CAS number of Methyl-6-bromohexanoate is 14273-90-6.
What is the European Community (EC) number of Methyl-6-bromohexanoate?
The European Community (EC) number of Methyl-6-bromohexanoate is 604-307-6.
What is the DSSTox Substance ID of Methyl-6-bromohexanoate?
The DSSTox Substance ID of Methyl-6-bromohexanoate is DTXSID60400224.
What is the XLogP3-AA value of Methyl-6-bromohexanoate?
The XLogP3-AA value of Methyl-6-bromohexanoate is 1.9.
Is Methyl-6-bromohexanoate a canonicalized compound?
Yes, Methyl-6-bromohexanoate is a canonicalized compound.