What is the molecular formula of 3,5-dibromopyridine?
The molecular formula of 3,5-dibromopyridine is C5H3Br2N.
What is the molecular weight of 3,5-dibromopyridine?
The molecular weight of 3,5-dibromopyridine is 236.89 g/mol.
What is the IUPAC name of 3,5-dibromopyridine?
The IUPAC name of 3,5-dibromopyridine is 3,5-dibromopyridine.
What is the InChI of 3,5-dibromopyridine?
The InChI of 3,5-dibromopyridine is InChI=1S/C5H3Br2N/c6-4-1-5(7)3-8-2-4/h1-3H.
What is the InChIKey of 3,5-dibromopyridine?
The InChIKey of 3,5-dibromopyridine is SOSPMXMEOFGPIM-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-dibromopyridine?
The canonical SMILES of 3,5-dibromopyridine is C1=C(C=NC=C1Br)Br.
What is the CAS number of 3,5-dibromopyridine?
The CAS number of 3,5-dibromopyridine is 625-92-3.
What is the European Community (EC) Number of 3,5-dibromopyridine?
The European Community (EC) Number of 3,5-dibromopyridine is 210-916-4.
What is the DSSTox Substance ID of 3,5-dibromopyridine?
The DSSTox Substance ID of 3,5-dibromopyridine is DTXSID3073921.
Is 3,5-dibromopyridine a canonicalized compound?
Yes, 3,5-dibromopyridine is a canonicalized compound.