What is the molecular formula of hexadecamethylcyclooctasiloxane?
The molecular formula of hexadecamethylcyclooctasiloxane is C16H48O8Si8.
What is the molecular weight of hexadecamethylcyclooctasiloxane?
The molecular weight of hexadecamethylcyclooctasiloxane is 593.2 g/mol.
What is the IUPAC name of hexadecamethylcyclooctasiloxane?
The IUPAC name of hexadecamethylcyclooctasiloxane is 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-hexadecamethyl-1,3,5,7,9,11,13,15-octaoxa-2,4,6,8,10,12,14,16-octasilacyclohexadecane.
What is the InChI key of hexadecamethylcyclooctasiloxane?
The InChI key of hexadecamethylcyclooctasiloxane is XKJMJYZFAWYREL-UHFFFAOYSA-N.
What is the canonical SMILES of hexadecamethylcyclooctasiloxane?
The canonical SMILES of hexadecamethylcyclooctasiloxane is C[Si]1(O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)C)C.
What is the CAS number of hexadecamethylcyclooctasiloxane?
The CAS number of hexadecamethylcyclooctasiloxane is 556-68-3.
How many hydrogen bond acceptors are there in hexadecamethylcyclooctasiloxane?
There are 8 hydrogen bond acceptors in hexadecamethylcyclooctasiloxane.
How many rotatable bonds are there in hexadecamethylcyclooctasiloxane?
The number of rotatable bonds in hexadecamethylcyclooctasiloxane is not provided in the reference.
What is the topological polar surface area of hexadecamethylcyclooctasiloxane?
The topological polar surface area of hexadecamethylcyclooctasiloxane is 73.8 Ų.
How many covalently-bonded units are there in hexadecamethylcyclooctasiloxane?
There is 1 covalently-bonded unit in hexadecamethylcyclooctasiloxane.
※ Please kindly note that our products are for research use only.