What is the molecular formula of doxorubicinol?
The molecular formula of doxorubicinol is C27H31NO11.
What are the synonyms for doxorubicinol?
The synonyms for doxorubicinol are Adriamycinol, 54193-28-1, and 13-Dihydrodoxorubicin.
What is the molecular weight of doxorubicinol?
The molecular weight of doxorubicinol is 545.5 g/mol.
What is the IUPAC name of doxorubicinol?
The IUPAC name of doxorubicinol is (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-[(1S)-1,2-dihydroxyethyl]-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
What is the InChI of doxorubicinol?
The InChI of doxorubicinol is InChI=1S/C27H31NO11/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34/h3-5,10,13,15-17,22,29-31,33,35-36H,6-9,28H2,1-2H3/t10-,13-,15-,16-,17-,22+,27-/m0/s1.
What is the InChIKey of doxorubicinol?
The InChIKey of doxorubicinol is NKZRZOVSJNSBFR-FEMMEMONSA-N.
What is the canonical SMILES of doxorubicinol?
The canonical SMILES of doxorubicinol is CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(CO)O)O)N)O.
What is the CAS number of doxorubicinol?
The CAS number of doxorubicinol is 54193-28-1.
What is the UNII of doxorubicinol?
The UNII of doxorubicinol is HUH05KI4CF.
What is the ChEMBL ID of doxorubicinol?
The ChEMBL ID of doxorubicinol is CHEMBL3277946.