What is the molecular formula of Fmoc-10-adc-oh?
The molecular formula of Fmoc-10-adc-oh is C25H31NO4.
What are the synonyms of Fmoc-10-adc-oh?
The synonyms of Fmoc-10-adc-oh are 143688-82-8 and 10-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)decanoic acid.
What is the molecular weight of Fmoc-10-adc-oh?
The molecular weight of Fmoc-10-adc-oh is 409.5 g/mol.
What is the IUPAC name of Fmoc-10-adc-oh?
The IUPAC name of Fmoc-10-adc-oh is 10-(9H-fluoren-9-ylmethoxycarbonylamino)decanoic acid.
What is the InChI of Fmoc-10-adc-oh?
The InChI of Fmoc-10-adc-oh is InChI=1S/C25H31NO4/c27-24(28)16-6-4-2-1-3-5-11-17-26-25(29)30-18-23-21-14-9-7-12-19(21)20-13-8-10-15-22(20)23/h7-10,12-15,23H,1-6,11,16-18H2,(H,26,29)(H,27,28).
What is the InChIKey of Fmoc-10-adc-oh?
The InChIKey of Fmoc-10-adc-oh is VRQUPGNWTJGCBX-UHFFFAOYSA-N.
What is the canonical SMILES of Fmoc-10-adc-oh?
The canonical SMILES of Fmoc-10-adc-oh is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCCCCCC(=O)O.
What is the CAS number of Fmoc-10-adc-oh?
The CAS number of Fmoc-10-adc-oh is 143688-82-8.
What is the XLogP3-AA value of Fmoc-10-adc-oh?
The XLogP3-AA value of Fmoc-10-adc-oh is 5.8.
What is the topological polar surface area of Fmoc-10-adc-oh?
The topological polar surface area of Fmoc-10-adc-oh is 75.6Ų.