What is the molecular formula of Colorformer Yellow CK-37?
The molecular formula of Colorformer Yellow CK-37 is C33H38N2O.
What are some synonyms for Colorformer Yellow CK-37?
Some synonyms for Colorformer Yellow CK-37 are N,N-Dimethyl-4-(2-(2-(octyloxy)phenyl)-6-phenylpyridin-4-yl)aniline and N,N-dimethyl-4-[2-(2-octoxyphenyl)-6-phenylpyridin-4-yl]aniline.
What is the molecular weight of Colorformer Yellow CK-37?
The molecular weight of Colorformer Yellow CK-37 is 478.7 g/mol.
When was Colorformer Yellow CK-37 created?
Colorformer Yellow CK-37 was created on December 4, 2007.
What is the IUPAC name of Colorformer Yellow CK-37?
The IUPAC name of Colorformer Yellow CK-37 is N,N-dimethyl-4-[2-(2-octoxyphenyl)-6-phenylpyridin-4-yl]aniline.
What is the InChI of Colorformer Yellow CK-37?
The InChI of Colorformer Yellow CK-37 is InChI=1S/C33H38N2O/c1-4-5-6-7-8-14-23-36-33-18-13-12-17-30(33)32-25-28(26-19-21-29(22-20-26)35(2)3)24-31(34-32)27-15-10-9-11-16-27/h9-13,15-22,24-25H,4-8,14,23H2,1-3H3.
What is the InChIKey of Colorformer Yellow CK-37?
The InChIKey of Colorformer Yellow CK-37 is GOCLJAKNIYYTMF-UHFFFAOYSA-N.
What is the canonical SMILES of Colorformer Yellow CK-37?
The canonical SMILES of Colorformer Yellow CK-37 is CCCCCCCCOC1=CC=CC=C1C2=CC(=CC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)N(C)C.
What is the CAS number of Colorformer Yellow CK-37?
The CAS number of Colorformer Yellow CK-37 is 144190-25-0.
What is the XLogP3-AA value of Colorformer Yellow CK-37?
The XLogP3-AA value of Colorformer Yellow CK-37 is 9.3.