What is the molecular formula of Fasoracetam?
The molecular formula of Fasoracetam is C10H16N2O2.
What is the molecular weight of Fasoracetam?
The molecular weight of Fasoracetam is 196.25 g/mol.
What is the IUPAC name of Fasoracetam?
The IUPAC name of Fasoracetam is (5R)-5-(piperidine-1-carbonyl)pyrrolidin-2-one.
What is the InChI of Fasoracetam?
The InChI of Fasoracetam is InChI=1S/C10H16N2O2/c13-9-5-4-8(11-9)10(14)12-6-2-1-3-7-12/h8H,1-7H2,(H,11,13)/t8-/m1/s1.
What is the InChIKey of Fasoracetam?
The InChIKey of Fasoracetam is GOWRRBABHQUJMX-MRVPVSSYSA-N.
What is the canonical SMILES of Fasoracetam?
The canonical SMILES of Fasoracetam is C1CCN(CC1)C(=O)C2CCC(=O)N2.
What is the CAS number of Fasoracetam?
The CAS number of Fasoracetam is 110958-19-5.
What is the ChEMBL ID of Fasoracetam?
The ChEMBL ID of Fasoracetam is CHEMBL2106179.
What is the topological polar surface area of Fasoracetam?
The topological polar surface area of Fasoracetam is 49.4?2.
What is the defined atom stereocenter count of Fasoracetam?
The defined atom stereocenter count of Fasoracetam is 1.