What is the molecular formula of Cortivazol?
The molecular formula of Cortivazol is C32H38N2O5.
What is the molecular weight of Cortivazol?
The molecular weight of Cortivazol is 530.7 g/mol.
What is the IUPAC name of Cortivazol?
The IUPAC name of Cortivazol is [2-[(1S,2R,13S,14S,16R,17R,18S,20S)-17,20-dihydroxy-2,11,16,18-tetramethyl-7-phenyl-6,7-diazapentacyclo[11.7.0.0 2,10 .0 4,8 .0 14,18 ]icosa-4(8),5,9,11-tetraen-17-yl]-2-oxoethyl] acetate.
What is the InChI of Cortivazol?
The InChI of Cortivazol is InChI=1S/C32H38N2O5/c1-18-11-23-25-12-19(2)32(38,28(37)17-39-20(3)35)31(25,5)15-27(36)29(23)30(4)14-21-16-33-34(26(21)13-24(18)30)22-9-7-6-8-10-22/h6-11,13,16,19,23,25,27,29,36,38H,12,14-15,17H2,1-5H3/t19-,23+,25+,27+,29-,30+,31+,32+/m1/s1.
What is the InChIKey of Cortivazol?
The InChIKey of Cortivazol is RKHQGWMMUURILY-UHRZLXHJSA-N.
What is the canonical SMILES of Cortivazol?
The canonical SMILES of Cortivazol is CC1CC2C3C=C(C4=CC5=C(CC4(C3C(CC2(C1(C(=O)COC(=O)C)O)C)O)C)C=NN5C6=CC=CC=C6)C.
What is the CAS number of Cortivazol?
The CAS number of Cortivazol is 1110-40-3.
What is the European Community (EC) number of Cortivazol?
The European Community (EC) number of Cortivazol is 214-175-8.
What is the UNII of Cortivazol?
The UNII of Cortivazol is YM183K0H63.
What is the ChEMBL ID of Cortivazol?
The ChEMBL ID of Cortivazol is CHEMBL2105842.