What is the molecular formula of Ethyl hydrocaffeate?
The molecular formula of Ethyl hydrocaffeate is C11H14O4.
What is the molecular weight of Ethyl hydrocaffeate?
The molecular weight of Ethyl hydrocaffeate is 210.23 g/mol.
What is the IUPAC name of Ethyl hydrocaffeate?
The IUPAC name of Ethyl hydrocaffeate is ethyl 3-(3,4-dihydroxyphenyl)propanoate.
What is the InChI of Ethyl hydrocaffeate?
The InChI of Ethyl hydrocaffeate is InChI=1S/C11H14O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3,5,7,12-13H,2,4,6H2,1H3.
What is the InChIKey of Ethyl hydrocaffeate?
The InChIKey of Ethyl hydrocaffeate is MHJZKZOOQLSKTN-UHFFFAOYSA-N.
What is the CAS number of Ethyl hydrocaffeate?
The CAS number of Ethyl hydrocaffeate is 3967-57-5.
What is the XLogP3 value of Ethyl hydrocaffeate?
The XLogP3 value of Ethyl hydrocaffeate is 0.2.
How many hydrogen bond donor counts does Ethyl hydrocaffeate have?
Ethyl hydrocaffeate has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethyl hydrocaffeate have?
Ethyl hydrocaffeate has 4 hydrogen bond acceptor counts.