What is the molecular formula of alminoprofen?
The molecular formula of alminoprofen is C13H17NO2.
What is the molecular weight of alminoprofen?
The molecular weight of alminoprofen is 219.28 g/mol.
What is the IUPAC name of alminoprofen?
The IUPAC name of alminoprofen is 2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid.
What is the InChIKey of alminoprofen?
The InChIKey of alminoprofen is FPHLBGOJWPEVME-UHFFFAOYSA-N.
What is the canonical SMILES of alminoprofen?
The canonical SMILES of alminoprofen is CC(C1=CC=C(C=C1)NCC(=C)C)C(=O)O.
What is the CAS number of alminoprofen?
The CAS number of alminoprofen is 39718-89-3.
What is the European Community (EC) number of alminoprofen?
The European Community (EC) number of alminoprofen is 254-604-6.
How many hydrogen bond donor counts does alminoprofen have?
Alminoprofen has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does alminoprofen have?
Alminoprofen has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of alminoprofen?
The topological polar surface area of alminoprofen is 49.3 Å2.