What is the molecular formula of EDDHA?
The molecular formula of EDDHA is C18H20N2O6.
What are the synonyms for EDDHA?
The synonyms for EDDHA are Eddha, Edbpha, 2,2'-(Ethane-1,2-diylbis(azanediyl))bis(2-(2-hydroxyphenyl)acetic acid), and Ethylenediamine-N,N'-bis((2-hydroxyphenyl)acetic acid).
What is the molecular weight of EDDHA?
The molecular weight of EDDHA is 360.4 g/mol.
When was EDDHA created and modified?
EDDHA was created on March 27, 2005, and modified on October 21, 2023.
What is the IUPAC name of EDDHA?
The IUPAC name of EDDHA is 2-[2-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid.
What is the InChI of EDDHA?
The InChI of EDDHA is InChI=1S/C18H20N2O6/c21-13-7-3-1-5-11(13)15(17(23)24)19-9-10-20-16(18(25)26)12-6-2-4-8-14(12)22/h1-8,15-16,19-22H,9-10H2,(H,23,24)(H,25,26).
What is the InChIKey of EDDHA?
The InChIKey of EDDHA is PZZHMLOHNYWKIK-UHFFFAOYSA-N.
What is the Canonical SMILES of EDDHA?
The Canonical SMILES of EDDHA is C1=CC=C(C(=C1)C(C(=O)O)NCCNC(C2=CC=CC=C2O)C(=O)O)O.
What are the CAS numbers associated with EDDHA?
The CAS numbers associated with EDDHA are 1170-02-1 and 6021-71-2 (iron(+3) salt).
What is the physical description of EDDHA?
EDDHA is described as a solid.