The molecular formula of the keyword is C19H32ClN3O4S.
What is the molecular weight of the keyword?
The molecular weight of the keyword is 434.0 g/mol.
What is the IUPAC name of the keyword?
The IUPAC name of the keyword is (3aR,6S,6aS)-4-methylsulfonyl-1-[(E)-4-piperidin-1-ylbut-2-enoyl]-6-propan-2-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one hydrochloride.
What is the InChI of the keyword?
The InChI of the keyword is InChI=1S/C19H31N3O4S.ClH/c1-14(2)17-18-15(22(19(17)24)27(3,25)26)9-13-21(18)16(23)8-7-12-20-10-5-4-6-11-20;/h7-8,14-15,17-18H,4-6,9-13H2,1-3H3;1H/b8-7+;/t15-,17+,18-;/m1./s1.
What is the Canonical SMILES of the keyword?
The Canonical SMILES of the keyword is CC(C)C1C2C(CCN2C(=O)C=CCN3CCCCC3)N(C1=O)S(=O)(=O)C.Cl.
What is the CAS number of the keyword?
The CAS number of the keyword is 197890-44-1.
What is the hydrogen bond donor count of the keyword?
The hydrogen bond donor count of the keyword is 1.
What is the hydrogen bond acceptor count of the keyword?
The hydrogen bond acceptor count of the keyword is 5.
What is the formal charge of the keyword?
The formal charge of the keyword is 0.
What is the complexity of the keyword?
The complexity of the keyword is 707.
※ Please kindly note that our products are for research use only.