What is the molecular formula of drospirenone?
The molecular formula of drospirenone is C24H30O3.
What is the molecular weight of drospirenone?
The molecular weight of drospirenone is 366.5 g/mol.
What is the IUPAC name of drospirenone?
The IUPAC name of drospirenone is (1R,2R,4R,10R,11S,14S,15S,16S,18S,19S)-10,14-dimethylspiro[hexacyclo[9.8.0.0 2,4 .0 5,10 .0 14,19 .0 16,18 ]nonadec-5-ene-15,5'-oxolane]-2',7-dione.
What are the synonyms of drospirenone?
The synonyms of drospirenone are Drospirenone, 67392-87-4, Dihydrospirorenone, Dehydrospirorenone, Drospirenona.
What is the InChI of drospirenone?
The InChI of drospirenone is InChI=1S/C24H30O3/c1-22-6-3-12(25)9-17(22)13-10-14(13)20-16(22)4-7-23(2)21(20)15-11-18(15)24(23)8-5-19(26)27-24/h9,13-16,18,20-21H,3-8,10-11H2,1-2H3/t13-,14+,15-,16+,18+,20-,21+,22-,23+,24+/m1/s1.
What is the PubChem CID of drospirenone?
The PubChem CID of drospirenone is 68873.
What is the CAS number of drospirenone?
The CAS number of drospirenone is 67392-87-4.
What is the ChEBI ID of drospirenone?
The ChEBI ID of drospirenone is CHEBI.
What is the DrugBank ID of drospirenone?
The DrugBank ID of drospirenone is DrugBank.
What is the FDA Pharm Class of drospirenone?
The FDA Pharm Class of drospirenone is Progestin.