What is the molecular formula of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The molecular formula is C22H29NO3.
What is the molecular weight of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The molecular weight is 355.5 g/mol.
What is the IUPAC name of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The IUPAC name is [(3E,8R,9S,10R,13S,14S,17R)-17-ethynyl-3-hydroxyimino-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
What is the InChI of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The InChI is InChI=1S/C22H29NO3/c1-4-22(26-14(2)24)12-10-20-19-7-5-15-13-16(23-25)6-8-17(15)18(19)9-11-21(20,22)3/h1,13,17-20,25H,5-12H2,2-3H3/b23-16+/t17-,18+,19+,20-,21-,22-/m0/s1.
What is the InChIKey of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The InChIKey is SCTDPGXGNWEFNF-LQRGBYOBSA-N.
What is the canonical SMILES of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The canonical SMILES is CC(=O)OC1(CCC2C1(CCC3C2CCC4=CC(=NO)CCC34)C)C#C.
What is the isomeric SMILES of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The isomeric SMILES is CC(=O)O[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C/C(=N/O)/CC[C@H]34)C)C#C.
What is the XLogP3 value of 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
The XLogP3 value is 3.8.
How many hydrogen bond donor counts are there in 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in 17-Alpha-ethynyl-19-nortestosterone acetate oxime?
There are 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.