What is the PubChem CID number for dioctyldineodecanoatetin?
The PubChem CID number for dioctyldineodecanoatetin is 87150950.
What is the molecular formula of dioctyldineodecanoatetin?
The molecular formula of dioctyldineodecanoatetin is C36H72O4Sn.
What are the synonyms for dioctyldineodecanoatetin?
The synonyms for dioctyldineodecanoatetin are SCHEMBL745657 and DIOCTYLDINEODECANOATETIN MFCD00271046.
What is the molecular weight of dioctyldineodecanoatetin?
The molecular weight of dioctyldineodecanoatetin is 687.7 g/mol.
When was dioctyldineodecanoatetin created?
Dioctyldineodecanoatetin was created on February 12, 2015.
When was dioctyldineodecanoatetin last modified?
Dioctyldineodecanoatetin was last modified on December 30, 2023.
What is the IUPAC name of dioctyldineodecanoatetin?
The IUPAC name of dioctyldineodecanoatetin is [7,7-dimethyloctanoyloxy(dioctyl)stannyl] 7,7-dimethyloctanoate.
What is the InChI of dioctyldineodecanoatetin?
The InChI of dioctyldineodecanoatetin is InChI=1S/2C10H20O2.2C8H17.Sn/c2*1-10(2,3)8-6-4-5-7-9(11)12;2*1-3-5-7-8-6-4-2;/h2*4-8H2,1-3H3,(H,11,12);2*1,3-8H2,2H3;/q;;;;+2/p-2.
What is the InChIKey of dioctyldineodecanoatetin?
The InChIKey of dioctyldineodecanoatetin is NXMOWTFIUDDXIT-UHFFFAOYSA-L.
What is the canonical SMILES of dioctyldineodecanoatetin?
The canonical SMILES of dioctyldineodecanoatetin is CCCCCCCC[Sn](CCCCCCCC)(OC(=O)CCCCCC(C)(C)C)OC(=O)CCCCCC(C)(C)C.