What is the molecular formula of Hexa(cyclohexyl)ditin?
The molecular formula of Hexa(cyclohexyl)ditin is C36H66Sn2.
What is the molecular weight of Hexa(cyclohexyl)ditin?
The molecular weight of Hexa(cyclohexyl)ditin is 736.3 g/mol.
What is the CAS number of Hexa(cyclohexyl)ditin?
The CAS number of Hexa(cyclohexyl)ditin is 3047-10-7.
What is the InChI of Hexa(cyclohexyl)ditin?
The InChI of Hexa(cyclohexyl)ditin is InChI=1S/6C6H11.2Sn/c6*1-2-4-6-5-3-1;;/h6*1H,2-6H2;;.
What is the InChIKey of Hexa(cyclohexyl)ditin?
The InChIKey of Hexa(cyclohexyl)ditin is DMDFHADZOZZWTC-UHFFFAOYSA-N.
What is the canonical SMILES of Hexa(cyclohexyl)ditin?
The canonical SMILES of Hexa(cyclohexyl)ditin is C1CCC(CC1)[Sn](C2CCCCC2)C3CCCCC3.C1CCC(CC1)[Sn](C2CCCCC2)C3CCCCC3.
What is the hydrogen bond donor count of Hexa(cyclohexyl)ditin?
The hydrogen bond donor count of Hexa(cyclohexyl)ditin is 0.
What is the hydrogen bond acceptor count of Hexa(cyclohexyl)ditin?
The hydrogen bond acceptor count of Hexa(cyclohexyl)ditin is 0.
What is the rotatable bond count of Hexa(cyclohexyl)ditin?
The rotatable bond count of Hexa(cyclohexyl)ditin is 6.
Is Hexa(cyclohexyl)ditin a canonicalized compound?
Yes, Hexa(cyclohexyl)ditin is a canonicalized compound.