What is the molecular formula of 3-Epiursolic acid?
The molecular formula of 3-Epiursolic acid is C30H48O3.
What are some synonyms of 3-Epiursolic acid?
Some synonyms of 3-Epiursolic acid are 3-epi-ursolic acid, 989-30-0, and CHEMBL491715.
What is the molecular weight of 3-Epiursolic acid?
The molecular weight of 3-Epiursolic acid is 456.7 g/mol.
When was 3-Epiursolic acid created?
3-Epiursolic acid was created on July 29, 2006.
What are the natural sources of 3-Epiursolic acid?
3-Epiursolic acid is found in Pavetta indica, Conandron ramondioides, and other organisms.
What is the IUPAC name of 3-Epiursolic acid?
The IUPAC name of 3-Epiursolic acid is (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid.
What is the InChIKey of 3-Epiursolic acid?
The InChIKey of 3-Epiursolic acid is WCGUUGGRBIKTOS-XHINXETDSA-N.
What is the canonical SMILES of 3-Epiursolic acid?
The canonical SMILES of 3-Epiursolic acid is CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1C)C)C(=O)O.
What is the XLogP3-AA value of 3-Epiursolic acid?
The XLogP3-AA value of 3-Epiursolic acid is 7.3.
※ Please kindly note that our products are for research use only.