What is the molecular formula of Akos b014096?
The molecular formula of Akos b014096 is C14H11FO2.
What is the molecular weight of Akos b014096?
The molecular weight of Akos b014096 is 230.23 g/mol.
When was Akos b014096 created?
Akos b014096 was created on July 9, 2005.
When was Akos b014096 last modified?
Akos b014096 was last modified on December 30, 2023.
What is the IUPAC name of Akos b014096?
The IUPAC name of Akos b014096 is 2-[(4-fluorophenyl)methoxy]benzaldehyde.
What is the InChI of Akos b014096?
The InChI of Akos b014096 is InChI=1S/C14H11FO2/c15-13-7-5-11(6-8-13)10-17-14-4-2-1-3-12(14)9-16/h1-9H,10H2.
What is the InChIKey of Akos b014096?
The InChIKey of Akos b014096 is OFOOGVHIOYRRGF-UHFFFAOYSA-N.
What is the canonical SMILES of Akos b014096?
The canonical SMILES of Akos b014096 is C1=CC=C(C(=C1)C=O)OCC2=CC=C(C=C2)F.
What is the CAS number of Akos b014096?
The CAS number of Akos b014096 is 98925-99-6.
What is the XLogP3-AA value of Akos b014096?
The XLogP3-AA value of Akos b014096 is 2.9.