What is the molecular formula of Cyclohexanepropanoicacid?
The molecular formula of Cyclohexanepropanoicacid is C15H27NO4.
What is the molecular weight of Cyclohexanepropanoicacid?
The molecular weight of Cyclohexanepropanoicacid is 285.38 g/mol.
What is the IUPAC name of Cyclohexanepropanoicacid?
The IUPAC name of Cyclohexanepropanoicacid is methyl (2S)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the InChI of Cyclohexanepropanoicacid?
The InChI of Cyclohexanepropanoicacid is InChI=1S/C15H27NO4/c1-15(2,3)20-14(18)16-12(13(17)19-4)10-11-8-6-5-7-9-11/h11-12H,5-10H2,1-4H3,(H,16,18)/t12-/m0/s1.
What is the InChIKey of Cyclohexanepropanoicacid?
The InChIKey of Cyclohexanepropanoicacid is FALUXMVPGFKLAM-LBPRGKRZSA-N.
What is the canonical SMILES of Cyclohexanepropanoicacid?
The canonical SMILES of Cyclohexanepropanoicacid is CC(C)(C)OC(=O)NC(CC1CCCCC1)C(=O)OC.
What is the isomeric SMILES of Cyclohexanepropanoicacid?
The isomeric SMILES of Cyclohexanepropanoicacid is CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(=O)OC.
What is the CAS number of Cyclohexanepropanoicacid?
The CAS number of Cyclohexanepropanoicacid is 98105-41-0.
What is the XLogP3-AA value of Cyclohexanepropanoicacid?
The XLogP3-AA value of Cyclohexanepropanoicacid is 4.
Is Cyclohexanepropanoicacid a canonicalized compound?
Yes, Cyclohexanepropanoicacid is a canonicalized compound.
※ Please kindly note that our products are for research use only.