What is the molecular formula of Sarafloxacin?
The molecular formula of Sarafloxacin is C20H17F2N3O3.
What is the molecular weight of Sarafloxacin?
The molecular weight of Sarafloxacin is 385.4 g/mol.
What is the IUPAC name of Sarafloxacin?
The IUPAC name of Sarafloxacin is 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid.
What is the InChI of Sarafloxacin?
The InChI of Sarafloxacin is InChI=1S/C20H17F2N3O3/c21-12-1-3-13(4-2-12)25-11-15(20(27)28)19(26)14-9-16(22)18(10-17(14)25)24-7-5-23-6-8-24/h1-4,9-11,23H,5-8H2,(H,27,28).
What is the InChIKey of Sarafloxacin?
The InChIKey of Sarafloxacin is XBHBWNFJWIASRO-UHFFFAOYSA-N.
What is the canonical SMILES of Sarafloxacin?
The canonical SMILES of Sarafloxacin is C1CN(CCN1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.
What is the CAS number of Sarafloxacin?
The CAS number of Sarafloxacin is 98105-99-8.
What is the ChEMBL ID of Sarafloxacin?
The ChEMBL ID of Sarafloxacin is CHEMBL37858.
What is the XLogP3 value of Sarafloxacin?
The XLogP3 value of Sarafloxacin is 0.3.